C24H37NO — CID 143322450
(5R)-1-[3-[(2E,5E)-6-cyclohepta-1,4,6-trien-1-ylhepta-2,5-dien-2-yl]oxypropyl]-3,5-dimethylpiperidine (PubChem CID 143322450) has the molecular formula C24H37NO and a molecular weight of 355.57 g/mol. Its IUPAC name is (5R)-1-[3-[(2E,5E)-6-cyclohepta-1,4,6-trien-1-ylhepta-2,5-dien-2-yl]oxypropyl]-3,5-dimethylpiperidine.
| Compound Name | (5R)-1-[3-[(2E,5E)-6-cyclohepta-1,4,6-trien-1-ylhepta-2,5-dien-2-yl]oxypropyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 143322450 |
| Molecular Formula | C24H37NO |
| Molecular Weight | 355.57 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | (5R)-1-[3-[(2E,5E)-6-cyclohepta-1,4,6-trien-1-ylhepta-2,5-dien-2-yl]oxypropyl]-3,5-dimethylpiperidine |
| SMILES | C/C(=C\C/C=C(\C)C1=CCC=CC=C1)OCCCN1CC(C)C[C@@H](C)C1 |
| InChI | InChI=1S/C24H37NO/c1-20-17-21(2)19-25(18-20)15-10-16-26-23(4)12-9-11-22(3)24-13-7-5-6-8-14-24/h5-7,11-14,20-21H,8-10,15-19H2,1-4H3/b22-11+,23-12+/t20-,21?/m1/s1 |
| InChIKey | YHTXCJSSSJSOMD-YJMIASIGSA-N |
| XLogP | 6.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|