About 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile
4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile (PubChem CID 143322717) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile.
Molecular Properties
| Compound Name | 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile |
| PubChem CID | 143322717 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile |
| SMILES | Cc1cc(OC2C(=O)NCC2(C)C)ccc1C#N |
| InChI | InChI=1S/C14H16N2O2/c1-9-6-11(5-4-10(9)7-15)18-12-13(17)16-8-14(12,2)3/h4-6,12H,8H2,1-3H3,(H,16,17) |
| InChIKey | XTVMDLYOODAILE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile?
The IUPAC name of 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile (CID 143322717) is 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile.
What is the SMILES notation for 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile?
The canonical SMILES for 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile is Cc1cc(OC2C(=O)NCC2(C)C)ccc1C#N.
What is the InChIKey of 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile?
The InChIKey is XTVMDLYOODAILE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O2/c1-9-6-11(5-4-10(9)7-15)18-12-13(17)16-8-14(12,2)3/h4-6,12H,8H2,1-3H3,(H,16,17).
What are the key properties of 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile?
4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile has a molecular weight of 244.29 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethyl-2-oxopyrrolidin-3-yl)oxy-2-methylbenzonitrile is sourced from PubChem (CID 143322717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).