C24H28 — CID 143323346
ethane;(5Z,7Z,9Z,13Z,15Z,17Z)-tetracyclo[9.8.1.05,20.012,19]icosa-1,5,7,9,11(20),12(19),13,15,17-nonaene (PubChem CID 143323346) has the molecular formula C24H28 and a molecular weight of 316.49 g/mol. Its IUPAC name is ethane;(5Z,7Z,9Z,13Z,15Z,17Z)-tetracyclo[9.8.1.05,20.012,19]icosa-1,5,7,9,11(20),12(19),13,15,17-nonaene.
| Compound Name | ethane;(5Z,7Z,9Z,13Z,15Z,17Z)-tetracyclo[9.8.1.05,20.012,19]icosa-1,5,7,9,11(20),12(19),13,15,17-nonaene |
|---|---|
| PubChem CID | 143323346 |
| Molecular Formula | C24H28 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | ethane;(5Z,7Z,9Z,13Z,15Z,17Z)-tetracyclo[9.8.1.05,20.012,19]icosa-1,5,7,9,11(20),12(19),13,15,17-nonaene |
| SMILES | C1=C2C3=C(/C=C\C=C/C=C\3)C3=C2/C(=C\C=C/C=C\3)CC1.CC.CC |
| InChI | InChI=1S/C20H16.2C2H6/c1-2-6-12-17-16(11-5-1)18-13-7-3-4-9-15-10-8-14-19(17)20(15)18;2*1-2/h1-7,9,11-14H,8,10H2;2*1-2H3/b2-1-,4-3-,5-1-,6-2-,7-3-,9-4-,11-5-,12-6-,13-7-,15-9-,16-11+,17-12+,18-13-;; |
| InChIKey | RDAFMTHPUYZNCB-YJJHOYOHSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |