About 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate
4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate (PubChem CID 143323722) has the molecular formula C6H7N2O2-
and a molecular weight of 139.13 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate.
Analyze 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate?
The IUPAC name of 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate (CID 143323722) is 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate.
What is the SMILES notation for 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate?
The canonical SMILES for 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate is [O-]c1noc2c1CCNC2.
What is the InChIKey of 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate?
The InChIKey is ZXRVKCBLGJOCEE-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8N2O2/c9-6-4-1-2-7-3-5(4)10-8-6/h7H,1-3H2,(H,8,9)/p-1.
What are the key properties of 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate?
4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate has a molecular weight of 139.13 g/mol, XLogP of -0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydro-[1,2]oxazolo[5,4-c]pyridin-3-olate is sourced from PubChem (CID 143323722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).