About 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane
2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane (PubChem CID 143323978) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane.
Molecular Properties
| Compound Name | 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane |
| PubChem CID | 143323978 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane |
| SMILES | CC.COCC(O)C1CC(=O)C(O)=C1O |
| InChI | InChI=1S/C8H12O5.C2H6/c1-13-3-6(10)4-2-5(9)8(12)7(4)11;1-2/h4,6,10-12H,2-3H2,1H3;1-2H3 |
| InChIKey | YHBRMHRXHGZRJH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane?
The IUPAC name of 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane (CID 143323978) is 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane.
What is the SMILES notation for 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane?
The canonical SMILES for 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane is CC.COCC(O)C1CC(=O)C(O)=C1O.
What is the InChIKey of 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane?
The InChIKey is YHBRMHRXHGZRJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5.C2H6/c1-13-3-6(10)4-2-5(9)8(12)7(4)11;1-2/h4,6,10-12H,2-3H2,1H3;1-2H3.
What are the key properties of 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane?
2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane has a molecular weight of 218.25 g/mol, XLogP of 0.94, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-4-(1-hydroxy-2-methoxyethyl)cyclopent-2-en-1-one;ethane is sourced from PubChem (CID 143323978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).