About 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen
6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen (PubChem CID 143324121) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen.
Molecular Properties
| Compound Name | 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen |
| PubChem CID | 143324121 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen |
| SMILES | CCC(C)Cc1ccc2cc[nH]c2n1.[H][H] |
| InChI | InChI=1S/C12H16N2.H2/c1-3-9(2)8-11-5-4-10-6-7-13-12(10)14-11;/h4-7,9H,3,8H2,1-2H3,(H,13,14);1H |
| InChIKey | IHZQEBSOKDODRX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen?
The IUPAC name of 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen (CID 143324121) is 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen.
What is the SMILES notation for 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen?
The canonical SMILES for 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen is CCC(C)Cc1ccc2cc[nH]c2n1.[H][H].
What is the InChIKey of 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen?
The InChIKey is IHZQEBSOKDODRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2.H2/c1-3-9(2)8-11-5-4-10-6-7-13-12(10)14-11;/h4-7,9H,3,8H2,1-2H3,(H,13,14);1H.
What are the key properties of 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen?
6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen has a molecular weight of 190.29 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-methylbutyl)-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen is sourced from PubChem (CID 143324121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).