C14H23F2NO — CID 143325462
4-[(4Z)-4,5-difluoro-2-methylhepta-2,4-dien-3-yl]-2,6-dimethylmorpholine (PubChem CID 143325462) has the molecular formula C14H23F2NO and a molecular weight of 259.34 g/mol. Its IUPAC name is 4-[(4Z)-4,5-difluoro-2-methylhepta-2,4-dien-3-yl]-2,6-dimethylmorpholine.
| Compound Name | 4-[(4Z)-4,5-difluoro-2-methylhepta-2,4-dien-3-yl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 143325462 |
| Molecular Formula | C14H23F2NO |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-[(4Z)-4,5-difluoro-2-methylhepta-2,4-dien-3-yl]-2,6-dimethylmorpholine |
| SMILES | CC/C(F)=C(/F)C(=C(C)C)N1CC(C)OC(C)C1 |
| InChI | InChI=1S/C14H23F2NO/c1-6-12(15)13(16)14(9(2)3)17-7-10(4)18-11(5)8-17/h10-11H,6-8H2,1-5H3/b13-12- |
| InChIKey | INTFRHHVQCYZAH-SEYXRHQNSA-N |
| XLogP | 3.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|