C13H23F3N2O — CID 143325754
[4-(1,1-diamino-2,2,2-trifluoroethyl)phenyl]methanol;ethane (PubChem CID 143325754) has the molecular formula C13H23F3N2O and a molecular weight of 280.33 g/mol. Its IUPAC name is [4-(1,1-diamino-2,2,2-trifluoroethyl)phenyl]methanol;ethane.
| Compound Name | [4-(1,1-diamino-2,2,2-trifluoroethyl)phenyl]methanol;ethane |
|---|---|
| PubChem CID | 143325754 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | [4-(1,1-diamino-2,2,2-trifluoroethyl)phenyl]methanol;ethane |
| SMILES | CC.CC.NC(N)(c1ccc(CO)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O.2C2H6/c10-9(11,12)8(13,14)7-3-1-6(5-15)2-4-7;2*1-2/h1-4,15H,5,13-14H2;2*1-2H3 |
| InChIKey | HHQRMUFUGHAWJI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|