C17H32O — CID 143325885
ethane;(3Z,5Z)-2-ethoxy-8-ethylundeca-1,3,5-triene (PubChem CID 143325885) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is ethane;(3Z,5Z)-2-ethoxy-8-ethylundeca-1,3,5-triene.
| Compound Name | ethane;(3Z,5Z)-2-ethoxy-8-ethylundeca-1,3,5-triene |
|---|---|
| PubChem CID | 143325885 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | ethane;(3Z,5Z)-2-ethoxy-8-ethylundeca-1,3,5-triene |
| SMILES | C=C(/C=C\C=C/CC(CC)CCC)OCC.CC |
| InChI | InChI=1S/C15H26O.C2H6/c1-5-11-15(6-2)13-10-8-9-12-14(4)16-7-3;1-2/h8-10,12,15H,4-7,11,13H2,1-3H3;1-2H3/b10-8-,12-9-; |
| InChIKey | FJRVMXQSRWNKGL-XXFFUJHZSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|