C12H20N2O — CID 143325960
2-[[(3Z,5E)-5-methyl-3-(methylamino)octa-1,3,5,7-tetraen-2-yl]amino]ethanol (PubChem CID 143325960) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-[[(3Z,5E)-5-methyl-3-(methylamino)octa-1,3,5,7-tetraen-2-yl]amino]ethanol.
| Compound Name | 2-[[(3Z,5E)-5-methyl-3-(methylamino)octa-1,3,5,7-tetraen-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 143325960 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-[[(3Z,5E)-5-methyl-3-(methylamino)octa-1,3,5,7-tetraen-2-yl]amino]ethanol |
| SMILES | C=C/C=C(C)/C=C(\NC)C(=C)NCCO |
| InChI | InChI=1S/C12H20N2O/c1-5-6-10(2)9-12(13-4)11(3)14-7-8-15/h5-6,9,13-15H,1,3,7-8H2,2,4H3/b10-6+,12-9- |
| InChIKey | DKJZTFNDKPAXCM-CQJQESKGSA-N |
| XLogP | 1.32 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|