C10H18N2O — CID 143326001
2-[[(2Z,4E)-2-amino-4-methylhepta-2,4,6-trienyl]amino]ethanol (PubChem CID 143326001) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-[[(2Z,4E)-2-amino-4-methylhepta-2,4,6-trienyl]amino]ethanol.
| Compound Name | 2-[[(2Z,4E)-2-amino-4-methylhepta-2,4,6-trienyl]amino]ethanol |
|---|---|
| PubChem CID | 143326001 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 2-[[(2Z,4E)-2-amino-4-methylhepta-2,4,6-trienyl]amino]ethanol |
| SMILES | C=C/C=C(C)/C=C(\N)CNCCO |
| InChI | InChI=1S/C10H18N2O/c1-3-4-9(2)7-10(11)8-12-5-6-13/h3-4,7,12-13H,1,5-6,8,11H2,2H3/b9-4+,10-7- |
| InChIKey | PYWZDHXOEPGUEX-MYAOFTLLSA-N |
| XLogP | 0.54 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|