C17H27N3O2 — CID 143326005
(2Z,4E,5Z)-2-acetamido-N-[1-(dimethylamino)propan-2-yl]-4-ethylideneocta-2,5,7-trienamide (PubChem CID 143326005) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is (2Z,4E,5Z)-2-acetamido-N-[1-(dimethylamino)propan-2-yl]-4-ethylideneocta-2,5,7-trienamide.
| Compound Name | (2Z,4E,5Z)-2-acetamido-N-[1-(dimethylamino)propan-2-yl]-4-ethylideneocta-2,5,7-trienamide |
|---|---|
| PubChem CID | 143326005 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (2Z,4E,5Z)-2-acetamido-N-[1-(dimethylamino)propan-2-yl]-4-ethylideneocta-2,5,7-trienamide |
| SMILES | C=C/C=C\C(\C=C(/NC(C)=O)C(=O)NC(C)CN(C)C)=C/C |
| InChI | InChI=1S/C17H27N3O2/c1-7-9-10-15(8-2)11-16(19-14(4)21)17(22)18-13(3)12-20(5)6/h7-11,13H,1,12H2,2-6H3,(H,18,22)(H,19,21)/b10-9-,15-8+,16-11- |
| InChIKey | MOTZMTDNISNISI-XRILXOCSSA-N |
| XLogP | 1.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|