C28H24F2N2O3S2 — CID 143326081
3,5-difluorobenzenethiol;4-[[5-(pyridin-2-ylmethylamino)-2,3-dihydro-1-benzothiophen-6-yl]oxymethyl]benzoic acid (PubChem CID 143326081) has the molecular formula C28H24F2N2O3S2 and a molecular weight of 538.64 g/mol. Its IUPAC name is 3,5-difluorobenzenethiol;4-[[5-(pyridin-2-ylmethylamino)-2,3-dihydro-1-benzothiophen-6-yl]oxymethyl]benzoic acid.
| Compound Name | 3,5-difluorobenzenethiol;4-[[5-(pyridin-2-ylmethylamino)-2,3-dihydro-1-benzothiophen-6-yl]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 143326081 |
| Molecular Formula | C28H24F2N2O3S2 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 3,5-difluorobenzenethiol;4-[[5-(pyridin-2-ylmethylamino)-2,3-dihydro-1-benzothiophen-6-yl]oxymethyl]benzoic acid |
| SMILES | Fc1cc(F)cc(S)c1.O=C(O)c1ccc(COc2cc3c(cc2NCc2ccccn2)CCS3)cc1 |
| InChI | InChI=1S/C22H20N2O3S.C6H4F2S/c25-22(26)16-6-4-15(5-7-16)14-27-20-12-21-17(8-10-28-21)11-19(20)24-13-18-3-1-2-9-23-18;7-4-1-5(8)3-6(9)2-4/h1-7,9,11-12,24H,8,10,13-14H2,(H,25,26);1-3,9H |
| InChIKey | AJZLONOTGYAHGY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|