C8H10O2 — CID 143326200
4,10-dioxatricyclo[5.2.1.02,6]dec-2(6)-ene (PubChem CID 143326200) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 4,10-dioxatricyclo[5.2.1.02,6]dec-2(6)-ene.
| Compound Name | 4,10-dioxatricyclo[5.2.1.02,6]dec-2(6)-ene |
|---|---|
| PubChem CID | 143326200 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 4,10-dioxatricyclo[5.2.1.02,6]dec-2(6)-ene |
| SMILES | C1OCC2=C1C1CCC2O1 |
| InChI | InChI=1S/C8H10O2/c1-2-8-6-4-9-3-5(6)7(1)10-8/h7-8H,1-4H2 |
| InChIKey | CVGSTWISMUEHCA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|