C13H19NS — CID 143326300
N-[(1Z,3E)-3-ethenyl-2-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]sulfanyl-N-methylmethanamine (PubChem CID 143326300) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is N-[(1Z,3E)-3-ethenyl-2-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]sulfanyl-N-methylmethanamine.
| Compound Name | N-[(1Z,3E)-3-ethenyl-2-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]sulfanyl-N-methylmethanamine |
|---|---|
| PubChem CID | 143326300 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | N-[(1Z,3E)-3-ethenyl-2-[(Z)-prop-1-enyl]hexa-1,3,5-trienyl]sulfanyl-N-methylmethanamine |
| SMILES | C=C/C=C(C=C)/C(/C=C\C)=C\SN(C)C |
| InChI | InChI=1S/C13H19NS/c1-6-9-12(8-3)13(10-7-2)11-15-14(4)5/h6-11H,1,3H2,2,4-5H3/b10-7-,12-9+,13-11- |
| InChIKey | STWAUGMUILQDRX-GLMWKCHBSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|