C5H10N2O — CID 143326338
(1E,3Z)-1,4-diaminopenta-1,3-dien-1-ol (PubChem CID 143326338) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is (1E,3Z)-1,4-diaminopenta-1,3-dien-1-ol.
| Compound Name | (1E,3Z)-1,4-diaminopenta-1,3-dien-1-ol |
|---|---|
| PubChem CID | 143326338 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | (1E,3Z)-1,4-diaminopenta-1,3-dien-1-ol |
| SMILES | C/C(N)=C/C=C(\N)O |
| InChI | InChI=1S/C5H10N2O/c1-4(6)2-3-5(7)8/h2-3,8H,6-7H2,1H3/b4-2-,5-3+ |
| InChIKey | NSDSMDOATLEZHJ-VOERYJCWSA-N |
| XLogP | 0.21 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|