C11H26N2 — CID 143326378
ethane;N-ethyl-N'-(2-methylprop-2-enyl)methanimidamide (PubChem CID 143326378) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is ethane;N-ethyl-N'-(2-methylprop-2-enyl)methanimidamide.
| Compound Name | ethane;N-ethyl-N'-(2-methylprop-2-enyl)methanimidamide |
|---|---|
| PubChem CID | 143326378 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | ethane;N-ethyl-N'-(2-methylprop-2-enyl)methanimidamide |
| SMILES | C=C(C)C/N=C/NCC.CC.CC |
| InChI | InChI=1S/C7H14N2.2C2H6/c1-4-8-6-9-5-7(2)3;2*1-2/h6H,2,4-5H2,1,3H3,(H,8,9);2*1-2H3 |
| InChIKey | NCNNOZKXJJIJDQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|