About fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate
fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate (PubChem CID 143326662) has the molecular formula C16H14F6N4O3
and a molecular weight of 424.30 g/mol. Its IUPAC name is fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| PubChem CID | 143326662 |
| Molecular Formula | C16H14F6N4O3 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(NNC(=O)c2ccc(C)cc2)nc1C(F)(F)F.FC(F)F |
| InChI | InChI=1S/C15H13F3N4O3.CHF3/c1-8-3-5-9(6-4-8)12(23)21-22-14-19-7-10(13(24)25-2)11(20-14)15(16,17)18;2-1(3)4/h3-7H,1-2H3,(H,21,23)(H,19,20,22);1H |
| InChIKey | GHGVXTQYRYQVLY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate?
The IUPAC name of fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate (CID 143326662) is fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate.
What is the SMILES notation for fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate?
The canonical SMILES for fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate is COC(=O)c1cnc(NNC(=O)c2ccc(C)cc2)nc1C(F)(F)F.FC(F)F.
What is the InChIKey of fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate?
The InChIKey is GHGVXTQYRYQVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N4O3.CHF3/c1-8-3-5-9(6-4-8)12(23)21-22-14-19-7-10(13(24)25-2)11(20-14)15(16,17)18;2-1(3)4/h3-7H,1-2H3,(H,21,23)(H,19,20,22);1H.
What are the key properties of fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate?
fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate has a molecular weight of 424.30 g/mol, XLogP of 3.53, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroform;methyl 2-[2-(4-methylbenzoyl)hydrazinyl]-4-(trifluoromethyl)pyrimidine-5-carboxylate is sourced from PubChem (CID 143326662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).