C19H26ClF3NO4P — CID 143327876
[2-(trifluoromethyl)cyclohexyl]methyl 2-[[(4-chlorophenoxy)-methylphosphoryl]amino]-2-methylpropanoate (PubChem CID 143327876) has the molecular formula C19H26ClF3NO4P and a molecular weight of 455.84 g/mol. Its IUPAC name is [2-(trifluoromethyl)cyclohexyl]methyl 2-[[(4-chlorophenoxy)-methylphosphoryl]amino]-2-methylpropanoate.
| Compound Name | [2-(trifluoromethyl)cyclohexyl]methyl 2-[[(4-chlorophenoxy)-methylphosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 143327876 |
| Molecular Formula | C19H26ClF3NO4P |
| Molecular Weight | 455.84 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [2-(trifluoromethyl)cyclohexyl]methyl 2-[[(4-chlorophenoxy)-methylphosphoryl]amino]-2-methylpropanoate |
| SMILES | CC(C)(NP(C)(=O)Oc1ccc(Cl)cc1)C(=O)OCC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C19H26ClF3NO4P/c1-18(2,24-29(3,26)28-15-10-8-14(20)9-11-15)17(25)27-12-13-6-4-5-7-16(13)19(21,22)23/h8-11,13,16H,4-7,12H2,1-3H3,(H,24,26) |
| InChIKey | BPHOZROPBZBBPH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.84 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|