About ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone
ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone (PubChem CID 143328145) has the molecular formula C10H19NOS2
and a molecular weight of 233.40 g/mol. Its IUPAC name is ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone.
Molecular Properties
| Compound Name | ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone |
| PubChem CID | 143328145 |
| Molecular Formula | C10H19NOS2 |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone |
| SMILES | CC.CC(=O)c1csc(=S)[nH]1.CCC |
| InChI | InChI=1S/C5H5NOS2.C3H8.C2H6/c1-3(7)4-2-9-5(8)6-4;1-3-2;1-2/h2H,1H3,(H,6,8);3H2,1-2H3;1-2H3 |
| InChIKey | PKRHGURMCSNMJE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone?
The IUPAC name of ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone (CID 143328145) is ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone.
What is the SMILES notation for ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone?
The canonical SMILES for ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone is CC.CC(=O)c1csc(=S)[nH]1.CCC.
What is the InChIKey of ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone?
The InChIKey is PKRHGURMCSNMJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NOS2.C3H8.C2H6/c1-3(7)4-2-9-5(8)6-4;1-3-2;1-2/h2H,1H3,(H,6,8);3H2,1-2H3;1-2H3.
What are the key properties of ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone?
ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone has a molecular weight of 233.40 g/mol, XLogP of 4.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propane;1-(2-sulfanylidene-3H-1,3-thiazol-4-yl)ethanone is sourced from PubChem (CID 143328145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).