C36H34FNO8S — CID 143328290
(3R,4R)-3-[2-(4-fluorophenyl)-2-oxoethyl]sulfinyl-4-[2-methyl-4-[4-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]phenyl]-1-phenylazetidin-2-one (PubChem CID 143328290) has the molecular formula C36H34FNO8S and a molecular weight of 659.73 g/mol. Its IUPAC name is (3R,4R)-3-[2-(4-fluorophenyl)-2-oxoethyl]sulfinyl-4-[2-methyl-4-[4-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]phenyl]-1-phenylazetidin-2-one.
| Compound Name | (3R,4R)-3-[2-(4-fluorophenyl)-2-oxoethyl]sulfinyl-4-[2-methyl-4-[4-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]phenyl]-1-phenylazetidin-2-one |
|---|---|
| PubChem CID | 143328290 |
| Molecular Formula | C36H34FNO8S |
| Molecular Weight | 659.73 g/mol |
| Exact Mass | 659.20 |
| IUPAC Name | (3R,4R)-3-[2-(4-fluorophenyl)-2-oxoethyl]sulfinyl-4-[2-methyl-4-[4-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]phenyl]-1-phenylazetidin-2-one |
| SMILES | Cc1cc(-c2ccc(C3O[C@H](CO)[C@@H](O)[C@H](O)C3O)cc2)ccc1[C@@H]1[C@@H](S(=O)CC(=O)c2ccc(F)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C36H34FNO8S/c1-20-17-24(21-7-9-23(10-8-21)34-33(43)32(42)31(41)29(18-39)46-34)13-16-27(20)30-35(36(44)38(30)26-5-3-2-4-6-26)47(45)19-28(40)22-11-14-25(37)15-12-22/h2-17,29-35,39,41-43H,18-19H2,1H3/t29-,30-,31-,32+,33?,34?,35-,47?/m1/s1 |
| InChIKey | MAHZAKVJIXMUOU-RSSBCYHPSA-N |
| XLogP | 3.40 |
| TPSA | 144.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |