C29H37F3N6S2 — CID 143328580
ethane;1-N-methyl-4-N-[4-(4-methyl-2-pyrazin-2-yl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-1-N-octyl-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 143328580) has the molecular formula C29H37F3N6S2 and a molecular weight of 590.79 g/mol. Its IUPAC name is ethane;1-N-methyl-4-N-[4-(4-methyl-2-pyrazin-2-yl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-1-N-octyl-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | ethane;1-N-methyl-4-N-[4-(4-methyl-2-pyrazin-2-yl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-1-N-octyl-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 143328580 |
| Molecular Formula | C29H37F3N6S2 |
| Molecular Weight | 590.79 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | ethane;1-N-methyl-4-N-[4-(4-methyl-2-pyrazin-2-yl-1,3-thiazol-5-yl)-1,3-thiazol-2-yl]-1-N-octyl-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | CC.CCCCCCCCN(C)c1ccc(Nc2nc(-c3sc(-c4cnccn4)nc3C)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H31F3N6S2.C2H6/c1-4-5-6-7-8-9-14-36(3)23-11-10-19(15-20(23)27(28,29)30)34-26-35-22(17-37-26)24-18(2)33-25(38-24)21-16-31-12-13-32-21;1-2/h10-13,15-17H,4-9,14H2,1-3H3,(H,34,35);1-2H3 |
| InChIKey | ZZVFETONKSHHQR-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.79 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|