C14H23N — CID 143328926
(3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane (PubChem CID 143328926) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane.
| Compound Name | (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane |
|---|---|
| PubChem CID | 143328926 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane |
| SMILES | C=C/C=C1/CCCNC/C1=C/C=C.CC |
| InChI | InChI=1S/C12H17N.C2H6/c1-3-6-11-8-5-9-13-10-12(11)7-4-2;1-2/h3-4,6-7,13H,1-2,5,8-10H2;1-2H3/b11-6-,12-7-; |
| InChIKey | YLAKQPOMDCBMTF-CVLCCZRFSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |