About (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane
(3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane (PubChem CID 143328926) has the molecular formula C14H23N
and a molecular weight of 205.34 g/mol. Its IUPAC name is (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane.
Molecular Properties
| Compound Name | (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane |
| PubChem CID | 143328926 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane |
| SMILES | C=C/C=C1/CCCNC/C1=C/C=C.CC |
| InChI | InChI=1S/C12H17N.C2H6/c1-3-6-11-8-5-9-13-10-12(11)7-4-2;1-2/h3-4,6-7,13H,1-2,5,8-10H2;1-2H3/b11-6-,12-7-; |
| InChIKey | YLAKQPOMDCBMTF-CVLCCZRFSA-N |
| XLogP | 3.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane?
The IUPAC name of (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane (CID 143328926) is (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane.
What is the SMILES notation for (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane?
The canonical SMILES for (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane is C=C/C=C1/CCCNC/C1=C/C=C.CC.
What is the InChIKey of (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane?
The InChIKey is YLAKQPOMDCBMTF-CVLCCZRFSA-N. The full InChI is InChI=1S/C12H17N.C2H6/c1-3-6-11-8-5-9-13-10-12(11)7-4-2;1-2/h3-4,6-7,13H,1-2,5,8-10H2;1-2H3/b11-6-,12-7-;.
What are the key properties of (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane?
(3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane has a molecular weight of 205.34 g/mol, XLogP of 3.62, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4Z)-3,4-bis(prop-2-enylidene)azepane;ethane is sourced from PubChem (CID 143328926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).