C13H20BO5P — CID 143329141
[4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-ethoxyphosphinic acid (PubChem CID 143329141) has the molecular formula C13H20BO5P and a molecular weight of 298.08 g/mol. Its IUPAC name is [4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-ethoxyphosphinic acid.
| Compound Name | [4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 143329141 |
| Molecular Formula | C13H20BO5P |
| Molecular Weight | 298.08 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-ethoxyphosphinic acid |
| SMILES | CCOP(=O)(O)c1ccc(B2OCC(C)(C)CO2)cc1 |
| InChI | InChI=1S/C13H20BO5P/c1-4-19-20(15,16)12-7-5-11(6-8-12)14-17-9-13(2,3)10-18-14/h5-8H,4,9-10H2,1-3H3,(H,15,16) |
| InChIKey | VMCRRYGBXCQUMS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.08 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|