C13H22O5 — CID 143329158
ethane;methyl 2-[(3aR,5S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-yl]acetate (PubChem CID 143329158) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is ethane;methyl 2-[(3aR,5S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-yl]acetate.
| Compound Name | ethane;methyl 2-[(3aR,5S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-yl]acetate |
|---|---|
| PubChem CID | 143329158 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | ethane;methyl 2-[(3aR,5S,6aR)-2,2-dimethyl-4-oxo-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-5-yl]acetate |
| SMILES | CC.COC(=O)C[C@@H]1C[C@H]2OC(C)(C)O[C@H]2C1=O |
| InChI | InChI=1S/C11H16O5.C2H6/c1-11(2)15-7-4-6(5-8(12)14-3)9(13)10(7)16-11;1-2/h6-7,10H,4-5H2,1-3H3;1-2H3/t6-,7+,10+;/m0./s1 |
| InChIKey | PPWYRMORQWGADN-LVJSCHTASA-N |
| XLogP | 1.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |