C18H20BrN5 — CID 143329185
11-(3-bromophenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine;ethane (PubChem CID 143329185) has the molecular formula C18H20BrN5 and a molecular weight of 386.30 g/mol. Its IUPAC name is 11-(3-bromophenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine;ethane.
| Compound Name | 11-(3-bromophenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine;ethane |
|---|---|
| PubChem CID | 143329185 |
| Molecular Formula | C18H20BrN5 |
| Molecular Weight | 386.30 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 11-(3-bromophenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine;ethane |
| SMILES | CC.CNc1nc2[nH]c(-c3cccc(Br)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C16H14BrN5.C2H6/c1-18-16-13-14(22(2)8-19-13)11-7-12(20-15(11)21-16)9-4-3-5-10(17)6-9;1-2/h3-8H,1-2H3,(H2,18,20,21);1-2H3 |
| InChIKey | MBLJZPSAZLQVMD-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.30 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |