C11H16FN — CID 143329432
(2E,4E)-5-fluoro-6-methyl-N-prop-1-en-2-ylhepta-2,4,6-trien-2-amine (PubChem CID 143329432) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is (2E,4E)-5-fluoro-6-methyl-N-prop-1-en-2-ylhepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4E)-5-fluoro-6-methyl-N-prop-1-en-2-ylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 143329432 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (2E,4E)-5-fluoro-6-methyl-N-prop-1-en-2-ylhepta-2,4,6-trien-2-amine |
| SMILES | C=C(C)N/C(C)=C/C=C(/F)C(=C)C |
| InChI | InChI=1S/C11H16FN/c1-8(2)11(12)7-6-10(5)13-9(3)4/h6-7,13H,1,3H2,2,4-5H3/b10-6+,11-7+ |
| InChIKey | CRKJBIJKVRDIJI-JMQWPVDRSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|