About 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide
1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide (PubChem CID 143329492) has the molecular formula C12H16ClN5
and a molecular weight of 265.75 g/mol. Its IUPAC name is 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide.
Molecular Properties
| Compound Name | 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide |
| PubChem CID | 143329492 |
| Molecular Formula | C12H16ClN5 |
| Molecular Weight | 265.75 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide |
| SMILES | C/N=C(N)/C(=N\C)C(/N)=N/c1cccc(Cl)c1C |
| InChI | InChI=1S/C12H16ClN5/c1-7-8(13)5-4-6-9(7)18-12(15)10(16-2)11(14)17-3/h4-6H,1-3H3,(H2,14,17)(H2,15,18)/b16-10+ |
| InChIKey | ZAYMFMGNCDUHCG-MHWRWJLKSA-N |
| XLogP | 1.69 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.75 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide?
The IUPAC name of 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide (CID 143329492) is 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide.
What is the SMILES notation for 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide?
The canonical SMILES for 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide is C/N=C(N)/C(=N\C)C(/N)=N/c1cccc(Cl)c1C.
What is the InChIKey of 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide?
The InChIKey is ZAYMFMGNCDUHCG-MHWRWJLKSA-N. The full InChI is InChI=1S/C12H16ClN5/c1-7-8(13)5-4-6-9(7)18-12(15)10(16-2)11(14)17-3/h4-6H,1-3H3,(H2,14,17)(H2,15,18)/b16-10+.
What are the key properties of 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide?
1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide has a molecular weight of 265.75 g/mol, XLogP of 1.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-(3-chloro-2-methylphenyl)-3-N'-methyl-2-methyliminopropanediimidamide is sourced from PubChem (CID 143329492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).