About 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one
5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one (PubChem CID 143329581) has the molecular formula C13H15F2NO2
and a molecular weight of 255.26 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one |
| PubChem CID | 143329581 |
| Molecular Formula | C13H15F2NO2 |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one |
| SMILES | C/C=C(O)\C=C/C(C)n1cc(C(F)F)ccc1=O |
| InChI | InChI=1S/C13H15F2NO2/c1-3-11(17)6-4-9(2)16-8-10(13(14)15)5-7-12(16)18/h3-9,13,17H,1-2H3/b6-4-,11-3+ |
| InChIKey | WCZFWUDVYBMKLM-TYTBFOFYSA-N |
| XLogP | 3.36 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one?
The IUPAC name of 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one (CID 143329581) is 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one.
What is the SMILES notation for 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one?
The canonical SMILES for 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one is C/C=C(O)\C=C/C(C)n1cc(C(F)F)ccc1=O.
What is the InChIKey of 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one?
The InChIKey is WCZFWUDVYBMKLM-TYTBFOFYSA-N. The full InChI is InChI=1S/C13H15F2NO2/c1-3-11(17)6-4-9(2)16-8-10(13(14)15)5-7-12(16)18/h3-9,13,17H,1-2H3/b6-4-,11-3+.
What are the key properties of 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one?
5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one has a molecular weight of 255.26 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-1-[(3Z,5E)-5-hydroxyhepta-3,5-dien-2-yl]pyridin-2-one is sourced from PubChem (CID 143329581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).