About [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite
[(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite (PubChem CID 143329907) has the molecular formula C7H9BrOS
and a molecular weight of 221.12 g/mol. Its IUPAC name is [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite.
Molecular Properties
| Compound Name | [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite |
| PubChem CID | 143329907 |
| Molecular Formula | C7H9BrOS |
| Molecular Weight | 221.12 g/mol |
| Exact Mass | 219.96 |
| IUPAC Name | [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite |
| SMILES | C=C(/C=C\C=C\O)CSBr |
| InChI | InChI=1S/C7H9BrOS/c1-7(6-10-8)4-2-3-5-9/h2-5,9H,1,6H2/b4-2-,5-3+ |
| InChIKey | XTMLEQXQLXMWSM-VOERYJCWSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite?
The IUPAC name of [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite (CID 143329907) is [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite.
What is the SMILES notation for [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite?
The canonical SMILES for [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite is C=C(/C=C\C=C\O)CSBr.
What is the InChIKey of [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite?
The InChIKey is XTMLEQXQLXMWSM-VOERYJCWSA-N. The full InChI is InChI=1S/C7H9BrOS/c1-7(6-10-8)4-2-3-5-9/h2-5,9H,1,6H2/b4-2-,5-3+.
What are the key properties of [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite?
[(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite has a molecular weight of 221.12 g/mol, XLogP of 3.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z,5E)-6-hydroxy-2-methylidenehexa-3,5-dienyl] thiohypobromite is sourced from PubChem (CID 143329907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).