About phenylselanylbenzene
phenylselanylbenzene (PubChem CID 14333) has the molecular formula C12H10Se
and a molecular weight of 233.17 g/mol. Its IUPAC name is phenylselanylbenzene.
Molecular Properties
| Compound Name | phenylselanylbenzene |
| PubChem CID | 14333 |
| Molecular Formula | C12H10Se |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.99 |
| IUPAC Name | phenylselanylbenzene |
| SMILES | c1ccc([Se]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10Se/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
| InChIKey | ORQWTLCYLDRDHK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenylselanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylselanylbenzene?
The IUPAC name of phenylselanylbenzene (CID 14333) is phenylselanylbenzene.
What is the SMILES notation for phenylselanylbenzene?
The canonical SMILES for phenylselanylbenzene is c1ccc([Se]c2ccccc2)cc1.
What is the InChIKey of phenylselanylbenzene?
The InChIKey is ORQWTLCYLDRDHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Se/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H.
What are the key properties of phenylselanylbenzene?
phenylselanylbenzene has a molecular weight of 233.17 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenylselanylbenzene is sourced from PubChem (CID 14333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).