C27H31N3O5S — CID 143330024
N-tert-butyl-1-[4-(5,9-diethoxy-6,8-dioxopyrrolo[3,4-g]quinolin-7-yl)-3-methylphenyl]methanesulfinamide (PubChem CID 143330024) has the molecular formula C27H31N3O5S and a molecular weight of 509.63 g/mol. Its IUPAC name is N-tert-butyl-1-[4-(5,9-diethoxy-6,8-dioxopyrrolo[3,4-g]quinolin-7-yl)-3-methylphenyl]methanesulfinamide.
| Compound Name | N-tert-butyl-1-[4-(5,9-diethoxy-6,8-dioxopyrrolo[3,4-g]quinolin-7-yl)-3-methylphenyl]methanesulfinamide |
|---|---|
| PubChem CID | 143330024 |
| Molecular Formula | C27H31N3O5S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N-tert-butyl-1-[4-(5,9-diethoxy-6,8-dioxopyrrolo[3,4-g]quinolin-7-yl)-3-methylphenyl]methanesulfinamide |
| SMILES | CCOc1c2c(c(OCC)c3ncccc13)C(=O)N(c1ccc(CS(=O)NC(C)(C)C)cc1C)C2=O |
| InChI | InChI=1S/C27H31N3O5S/c1-7-34-23-18-10-9-13-28-22(18)24(35-8-2)21-20(23)25(31)30(26(21)32)19-12-11-17(14-16(19)3)15-36(33)29-27(4,5)6/h9-14,29H,7-8,15H2,1-6H3 |
| InChIKey | KLRZFPWKGFZIFW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|