C26H27F6N3O6S — CID 143330063
ethane;7-formyl-N-methyl-N-[2-methyl-4-(sulfamoylmethyl)phenyl]-5,8-bis(2,2,2-trifluoroethoxy)quinoline-6-carboxamide (PubChem CID 143330063) has the molecular formula C26H27F6N3O6S and a molecular weight of 623.57 g/mol. Its IUPAC name is ethane;7-formyl-N-methyl-N-[2-methyl-4-(sulfamoylmethyl)phenyl]-5,8-bis(2,2,2-trifluoroethoxy)quinoline-6-carboxamide.
| Compound Name | ethane;7-formyl-N-methyl-N-[2-methyl-4-(sulfamoylmethyl)phenyl]-5,8-bis(2,2,2-trifluoroethoxy)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 143330063 |
| Molecular Formula | C26H27F6N3O6S |
| Molecular Weight | 623.57 g/mol |
| Exact Mass | 623.15 |
| IUPAC Name | ethane;7-formyl-N-methyl-N-[2-methyl-4-(sulfamoylmethyl)phenyl]-5,8-bis(2,2,2-trifluoroethoxy)quinoline-6-carboxamide |
| SMILES | CC.Cc1cc(CS(N)(=O)=O)ccc1N(C)C(=O)c1c(C=O)c(OCC(F)(F)F)c2ncccc2c1OCC(F)(F)F |
| InChI | InChI=1S/C24H21F6N3O6S.C2H6/c1-13-8-14(10-40(31,36)37)5-6-17(13)33(2)22(35)18-16(9-34)21(39-12-24(28,29)30)19-15(4-3-7-32-19)20(18)38-11-23(25,26)27;1-2/h3-9H,10-12H2,1-2H3,(H2,31,36,37);1-2H3 |
| InChIKey | GLDNQZMJYHLMMT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 128.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|