C13H30N2 — CID 143330419
ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine (PubChem CID 143330419) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine.
| Compound Name | ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine |
|---|---|
| PubChem CID | 143330419 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | ethane;(Z)-2-N-methyl-4-N-methylidenepent-3-ene-2,4-diimine |
| SMILES | C=N/C(C)=C\C(C)=N\C.CC.CC.CC |
| InChI | InChI=1S/C7H12N2.3C2H6/c1-6(8-3)5-7(2)9-4;3*1-2/h5H,3H2,1-2,4H3;3*1-2H3/b6-5-,9-7+;;; |
| InChIKey | CTGFBLSIEUCTMC-LAQJPSDGSA-N |
| XLogP | 4.76 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|