C9H15F3N2O2S — CID 143330821
ethanol;5-ethylsulfinyl-1-methyl-3-(trifluoromethyl)pyrazole (PubChem CID 143330821) has the molecular formula C9H15F3N2O2S and a molecular weight of 272.29 g/mol. Its IUPAC name is ethanol;5-ethylsulfinyl-1-methyl-3-(trifluoromethyl)pyrazole.
| Compound Name | ethanol;5-ethylsulfinyl-1-methyl-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 143330821 |
| Molecular Formula | C9H15F3N2O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | ethanol;5-ethylsulfinyl-1-methyl-3-(trifluoromethyl)pyrazole |
| SMILES | CCO.CCS(=O)c1cc(C(F)(F)F)nn1C |
| InChI | InChI=1S/C7H9F3N2OS.C2H6O/c1-3-14(13)6-4-5(7(8,9)10)11-12(6)2;1-2-3/h4H,3H2,1-2H3;3H,2H2,1H3 |
| InChIKey | YXYIMOYNAOPSIQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |