C10H12FNS — CID 143331081
5-[(2Z,4E)-4-fluorohexa-2,4-dienyl]-2-methyl-1,3-thiazole (PubChem CID 143331081) has the molecular formula C10H12FNS and a molecular weight of 197.28 g/mol. Its IUPAC name is 5-[(2Z,4E)-4-fluorohexa-2,4-dienyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[(2Z,4E)-4-fluorohexa-2,4-dienyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 143331081 |
| Molecular Formula | C10H12FNS |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-[(2Z,4E)-4-fluorohexa-2,4-dienyl]-2-methyl-1,3-thiazole |
| SMILES | C/C=C(F)\C=C/Cc1cnc(C)s1 |
| InChI | InChI=1S/C10H12FNS/c1-3-9(11)5-4-6-10-7-12-8(2)13-10/h3-5,7H,6H2,1-2H3/b5-4-,9-3+ |
| InChIKey | QNAJFMORZLJYNT-SMPMWSNWSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|