C13H21FN2O — CID 143331095
ethane;2-[(2E,4Z)-6-fluoro-6-methylhepta-2,4-dien-3-yl]-5-methyl-1,3,4-oxadiazole (PubChem CID 143331095) has the molecular formula C13H21FN2O and a molecular weight of 240.32 g/mol. Its IUPAC name is ethane;2-[(2E,4Z)-6-fluoro-6-methylhepta-2,4-dien-3-yl]-5-methyl-1,3,4-oxadiazole.
| Compound Name | ethane;2-[(2E,4Z)-6-fluoro-6-methylhepta-2,4-dien-3-yl]-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143331095 |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | ethane;2-[(2E,4Z)-6-fluoro-6-methylhepta-2,4-dien-3-yl]-5-methyl-1,3,4-oxadiazole |
| SMILES | C/C=C(\C=C/C(C)(C)F)c1nnc(C)o1.CC |
| InChI | InChI=1S/C11H15FN2O.C2H6/c1-5-9(6-7-11(3,4)12)10-14-13-8(2)15-10;1-2/h5-7H,1-4H3;1-2H3/b7-6-,9-5+; |
| InChIKey | VMHLFOQINXCYFX-YVCPEMMASA-N |
| XLogP | 4.11 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|