C22H23F2N3O2 — CID 143331239
methyl 4-fluoro-N-[2-[(3R)-1-(5-fluoropyridine-3-carbonyl)piperidin-3-yl]prop-2-enyl]benzenecarboximidate (PubChem CID 143331239) has the molecular formula C22H23F2N3O2 and a molecular weight of 399.44 g/mol. Its IUPAC name is methyl 4-fluoro-N-[2-[(3R)-1-(5-fluoropyridine-3-carbonyl)piperidin-3-yl]prop-2-enyl]benzenecarboximidate.
| Compound Name | methyl 4-fluoro-N-[2-[(3R)-1-(5-fluoropyridine-3-carbonyl)piperidin-3-yl]prop-2-enyl]benzenecarboximidate |
|---|---|
| PubChem CID | 143331239 |
| Molecular Formula | C22H23F2N3O2 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | methyl 4-fluoro-N-[2-[(3R)-1-(5-fluoropyridine-3-carbonyl)piperidin-3-yl]prop-2-enyl]benzenecarboximidate |
| SMILES | C=C(C/N=C(\OC)c1ccc(F)cc1)[C@H]1CCCN(C(=O)c2cncc(F)c2)C1 |
| InChI | InChI=1S/C22H23F2N3O2/c1-15(11-26-21(29-2)16-5-7-19(23)8-6-16)17-4-3-9-27(14-17)22(28)18-10-20(24)13-25-12-18/h5-8,10,12-13,17H,1,3-4,9,11,14H2,2H3/b26-21-/t17-/m0/s1 |
| InChIKey | FYERUHFDQLCQFS-OEJOWEAXSA-N |
| XLogP | 3.86 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|