C30H54O — CID 143331387
butane;5-[(2Z)-2-ethylidene-3,3,4,4-tetramethylpentyl]tetracyclo[6.2.1.02,7.03,6]undecane-9-carbaldehyde;propane (PubChem CID 143331387) has the molecular formula C30H54O and a molecular weight of 430.76 g/mol. Its IUPAC name is butane;5-[(2Z)-2-ethylidene-3,3,4,4-tetramethylpentyl]tetracyclo[6.2.1.02,7.03,6]undecane-9-carbaldehyde;propane.
| Compound Name | butane;5-[(2Z)-2-ethylidene-3,3,4,4-tetramethylpentyl]tetracyclo[6.2.1.02,7.03,6]undecane-9-carbaldehyde;propane |
|---|---|
| PubChem CID | 143331387 |
| Molecular Formula | C30H54O |
| Molecular Weight | 430.76 g/mol |
| Exact Mass | 430.42 |
| IUPAC Name | butane;5-[(2Z)-2-ethylidene-3,3,4,4-tetramethylpentyl]tetracyclo[6.2.1.02,7.03,6]undecane-9-carbaldehyde;propane |
| SMILES | C/C=C(/CC1CC2C1C1C3CC(CC3C=O)C21)C(C)(C)C(C)(C)C.CCC.CCCC |
| InChI | InChI=1S/C23H36O.C4H10.C3H8/c1-7-16(23(5,6)22(2,3)4)9-14-11-18-19-13-8-15(12-24)17(10-13)21(19)20(14)18;1-3-4-2;1-3-2/h7,12-15,17-21H,8-11H2,1-6H3;3-4H2,1-2H3;3H2,1-2H3/b16-7-;; |
| InChIKey | GOXDHGZQADVXQR-ZYMKCKPMSA-N |
| XLogP | 8.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.76 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|