About (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine
(Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine (PubChem CID 143331689) has the molecular formula C15H24N2S
and a molecular weight of 264.44 g/mol. Its IUPAC name is (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine.
Molecular Properties
| Compound Name | (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine |
| PubChem CID | 143331689 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine |
| SMILES | C=CS/C(=C\C)C/N=C(CC)/C(CC)=C(/C)N=C |
| InChI | InChI=1S/C15H24N2S/c1-7-13(18-10-4)11-17-15(9-3)14(8-2)12(5)16-6/h7,10H,4,6,8-9,11H2,1-3,5H3/b13-7-,14-12-,17-15+ |
| InChIKey | AKWPDOGDLKIOFY-QYBJWGGJSA-N |
| XLogP | 5.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine?
The IUPAC name of (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine (CID 143331689) is (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine.
What is the SMILES notation for (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine?
The canonical SMILES for (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine is C=CS/C(=C\C)C/N=C(CC)/C(CC)=C(/C)N=C.
What is the InChIKey of (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine?
The InChIKey is AKWPDOGDLKIOFY-QYBJWGGJSA-N. The full InChI is InChI=1S/C15H24N2S/c1-7-13(18-10-4)11-17-15(9-3)14(8-2)12(5)16-6/h7,10H,4,6,8-9,11H2,1-3,5H3/b13-7-,14-12-,17-15+.
What are the key properties of (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine?
(Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine has a molecular weight of 264.44 g/mol, XLogP of 5.00, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-N-[(Z)-2-ethenylsulfanylbut-2-enyl]-4-ethyl-5-N-methylidenehex-4-ene-3,5-diimine is sourced from PubChem (CID 143331689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).