C17H24 — CID 143332137
5-[(2Z,4Z)-hepta-2,4,6-trienyl]-1-propylcyclohepta-1,3-diene (PubChem CID 143332137) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 5-[(2Z,4Z)-hepta-2,4,6-trienyl]-1-propylcyclohepta-1,3-diene.
| Compound Name | 5-[(2Z,4Z)-hepta-2,4,6-trienyl]-1-propylcyclohepta-1,3-diene |
|---|---|
| PubChem CID | 143332137 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 5-[(2Z,4Z)-hepta-2,4,6-trienyl]-1-propylcyclohepta-1,3-diene |
| SMILES | C=C/C=C\C=C/CC1C=CC=C(CCC)CC1 |
| InChI | InChI=1S/C17H24/c1-3-5-6-7-8-11-17-13-9-12-16(10-4-2)14-15-17/h3,5-9,12-13,17H,1,4,10-11,14-15H2,2H3/b6-5-,8-7- |
| InChIKey | IZUZJUOFDJXQKC-ISTTXYCBSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|