About 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one
4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one (PubChem CID 143332283) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one.
Molecular Properties
| Compound Name | 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one |
| PubChem CID | 143332283 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one |
| SMILES | CCCCOC/C=C(\C=C/COC)CC1CNC(=O)N1 |
| InChI | InChI=1S/C15H26N2O3/c1-3-4-9-20-10-7-13(6-5-8-19-2)11-14-12-16-15(18)17-14/h5-7,14H,3-4,8-12H2,1-2H3,(H2,16,17,18)/b6-5-,13-7+ |
| InChIKey | NBNBWEGAMDDFOA-RKOYKYSNSA-N |
| XLogP | 2.00 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one?
The IUPAC name of 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one (CID 143332283) is 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one.
What is the SMILES notation for 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one?
The canonical SMILES for 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one is CCCCOC/C=C(\C=C/COC)CC1CNC(=O)N1.
What is the InChIKey of 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one?
The InChIKey is NBNBWEGAMDDFOA-RKOYKYSNSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-3-4-9-20-10-7-13(6-5-8-19-2)11-14-12-16-15(18)17-14/h5-7,14H,3-4,8-12H2,1-2H3,(H2,16,17,18)/b6-5-,13-7+.
What are the key properties of 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one?
4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one has a molecular weight of 282.38 g/mol, XLogP of 2.00, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z,2Z)-2-(2-butoxyethylidene)-5-methoxypent-3-enyl]imidazolidin-2-one is sourced from PubChem (CID 143332283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).