C23H36N2O2 — CID 143332870
4-(ethylamino)-2,3-dimethylbenzonitrile;(E)-3-[[(E)-3-methylbut-1-enoxy]methoxy]hex-3-ene (PubChem CID 143332870) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is 4-(ethylamino)-2,3-dimethylbenzonitrile;(E)-3-[[(E)-3-methylbut-1-enoxy]methoxy]hex-3-ene.
| Compound Name | 4-(ethylamino)-2,3-dimethylbenzonitrile;(E)-3-[[(E)-3-methylbut-1-enoxy]methoxy]hex-3-ene |
|---|---|
| PubChem CID | 143332870 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 4-(ethylamino)-2,3-dimethylbenzonitrile;(E)-3-[[(E)-3-methylbut-1-enoxy]methoxy]hex-3-ene |
| SMILES | CC/C=C(\CC)OCO/C=C/C(C)C.CCNc1ccc(C#N)c(C)c1C |
| InChI | InChI=1S/C12H22O2.C11H14N2/c1-5-7-12(6-2)14-10-13-9-8-11(3)4;1-4-13-11-6-5-10(7-12)8(2)9(11)3/h7-9,11H,5-6,10H2,1-4H3;5-6,13H,4H2,1-3H3/b9-8+,12-7+; |
| InChIKey | ALUHWNLTPUXOME-HJSFOAQASA-N |
| XLogP | 6.46 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|