C17H33N — CID 143332988
N,3-dimethylbut-3-en-1-amine;1-methyl-3-(3-methylbut-3-enyl)cyclopentane (PubChem CID 143332988) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is N,3-dimethylbut-3-en-1-amine;1-methyl-3-(3-methylbut-3-enyl)cyclopentane.
| Compound Name | N,3-dimethylbut-3-en-1-amine;1-methyl-3-(3-methylbut-3-enyl)cyclopentane |
|---|---|
| PubChem CID | 143332988 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | N,3-dimethylbut-3-en-1-amine;1-methyl-3-(3-methylbut-3-enyl)cyclopentane |
| SMILES | C=C(C)CCC1CCC(C)C1.C=C(C)CCNC |
| InChI | InChI=1S/C11H20.C6H13N/c1-9(2)4-6-11-7-5-10(3)8-11;1-6(2)4-5-7-3/h10-11H,1,4-8H2,2-3H3;7H,1,4-5H2,2-3H3 |
| InChIKey | COCYNCPSCRFWBV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|