C11H14N2O3 — CID 143332994
2,5-dimethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione;ethane (PubChem CID 143332994) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2,5-dimethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione;ethane.
| Compound Name | 2,5-dimethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione;ethane |
|---|---|
| PubChem CID | 143332994 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2,5-dimethyl-3H-pyrano[2,3-d]pyrimidine-4,7-dione;ethane |
| SMILES | CC.Cc1nc2oc(=O)cc(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C9H8N2O3.C2H6/c1-4-3-6(12)14-9-7(4)8(13)10-5(2)11-9;1-2/h3H,1-2H3,(H,10,11,13);1-2H3 |
| InChIKey | OKUIGMMUERNPJB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |