C22H22F3N3O5 — CID 143333044
5-(2-cyclopentylethyl)-2-[2-[[4-(trifluoromethyl)-2-pyridinyl]oxy]ethoxy]-3H-pyrano[2,3-d]pyrimidine-4,7-dione (PubChem CID 143333044) has the molecular formula C22H22F3N3O5 and a molecular weight of 465.43 g/mol. Its IUPAC name is 5-(2-cyclopentylethyl)-2-[2-[[4-(trifluoromethyl)-2-pyridinyl]oxy]ethoxy]-3H-pyrano[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-cyclopentylethyl)-2-[2-[[4-(trifluoromethyl)-2-pyridinyl]oxy]ethoxy]-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 143333044 |
| Molecular Formula | C22H22F3N3O5 |
| Molecular Weight | 465.43 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 5-(2-cyclopentylethyl)-2-[2-[[4-(trifluoromethyl)-2-pyridinyl]oxy]ethoxy]-3H-pyrano[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=c1cc(CCC2CCCC2)c2c(=O)[nH]c(OCCOc3cc(C(F)(F)F)ccn3)nc2o1 |
| InChI | InChI=1S/C22H22F3N3O5/c23-22(24,25)15-7-8-26-16(12-15)31-9-10-32-21-27-19(30)18-14(6-5-13-3-1-2-4-13)11-17(29)33-20(18)28-21/h7-8,11-13H,1-6,9-10H2,(H,27,28,30) |
| InChIKey | LOUZSHKHDDNZAV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 107.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|