C7H12N2O — CID 14333308
(3R,7aS)-3-methyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-1-one (PubChem CID 14333308) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (3R,7aS)-3-methyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-1-one.
| Compound Name | (3R,7aS)-3-methyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-1-one |
|---|---|
| PubChem CID | 14333308 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (3R,7aS)-3-methyl-2,3,5,6,7,7a-hexahydropyrrolo[1,2-c]imidazol-1-one |
| SMILES | C[C@@H]1NC(=O)[C@@H]2CCCN12 |
| InChI | InChI=1S/C7H12N2O/c1-5-8-7(10)6-3-2-4-9(5)6/h5-6H,2-4H2,1H3,(H,8,10)/t5-,6+/m1/s1 |
| InChIKey | NSZCSMXBLPPGNT-RITPCOANSA-N |
| XLogP | -0.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |