About butane;4-methylidene-2,3-dihydro-1H-quinoline
butane;4-methylidene-2,3-dihydro-1H-quinoline (PubChem CID 143333424) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is butane;4-methylidene-2,3-dihydro-1H-quinoline.
Molecular Properties
| Compound Name | butane;4-methylidene-2,3-dihydro-1H-quinoline |
| PubChem CID | 143333424 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | butane;4-methylidene-2,3-dihydro-1H-quinoline |
| SMILES | C=C1CCNc2ccccc21.CCCC |
| InChI | InChI=1S/C10H11N.C4H10/c1-8-6-7-11-10-5-3-2-4-9(8)10;1-3-4-2/h2-5,11H,1,6-7H2;3-4H2,1-2H3 |
| InChIKey | TWQZKJMUFCITCH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;4-methylidene-2,3-dihydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;4-methylidene-2,3-dihydro-1H-quinoline?
The IUPAC name of butane;4-methylidene-2,3-dihydro-1H-quinoline (CID 143333424) is butane;4-methylidene-2,3-dihydro-1H-quinoline.
What is the SMILES notation for butane;4-methylidene-2,3-dihydro-1H-quinoline?
The canonical SMILES for butane;4-methylidene-2,3-dihydro-1H-quinoline is C=C1CCNc2ccccc21.CCCC.
What is the InChIKey of butane;4-methylidene-2,3-dihydro-1H-quinoline?
The InChIKey is TWQZKJMUFCITCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C4H10/c1-8-6-7-11-10-5-3-2-4-9(8)10;1-3-4-2/h2-5,11H,1,6-7H2;3-4H2,1-2H3.
What are the key properties of butane;4-methylidene-2,3-dihydro-1H-quinoline?
butane;4-methylidene-2,3-dihydro-1H-quinoline has a molecular weight of 203.33 g/mol, XLogP of 4.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;4-methylidene-2,3-dihydro-1H-quinoline is sourced from PubChem (CID 143333424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).