About N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane
N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane (PubChem CID 143333835) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane |
| PubChem CID | 143333835 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane |
| SMILES | C=C(/C=C\C)N(C=O)CCN.CC |
| InChI | InChI=1S/C8H14N2O.C2H6/c1-3-4-8(2)10(7-11)6-5-9;1-2/h3-4,7H,2,5-6,9H2,1H3;1-2H3/b4-3-; |
| InChIKey | SJSZTPAICQCZFU-LNKPDPKZSA-N |
| XLogP | 1.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane?
The IUPAC name of N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane (CID 143333835) is N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane.
What is the SMILES notation for N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane?
The canonical SMILES for N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane is C=C(/C=C\C)N(C=O)CCN.CC.
What is the InChIKey of N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane?
The InChIKey is SJSZTPAICQCZFU-LNKPDPKZSA-N. The full InChI is InChI=1S/C8H14N2O.C2H6/c1-3-4-8(2)10(7-11)6-5-9;1-2/h3-4,7H,2,5-6,9H2,1H3;1-2H3/b4-3-;.
What are the key properties of N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane?
N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane has a molecular weight of 184.28 g/mol, XLogP of 1.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-N-[(3Z)-penta-1,3-dien-2-yl]formamide;ethane is sourced from PubChem (CID 143333835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).