C11H16 — CID 143333898
(1Z,6Z)-1,5,7-trimethylcycloocta-1,3,6-triene (PubChem CID 143333898) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (1Z,6Z)-1,5,7-trimethylcycloocta-1,3,6-triene.
| Compound Name | (1Z,6Z)-1,5,7-trimethylcycloocta-1,3,6-triene |
|---|---|
| PubChem CID | 143333898 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (1Z,6Z)-1,5,7-trimethylcycloocta-1,3,6-triene |
| SMILES | C/C1=C/C=CC(C)/C=C(/C)C1 |
| InChI | InChI=1S/C11H16/c1-9-5-4-6-10(2)8-11(3)7-9/h4-7,9H,8H2,1-3H3/b5-4?,10-6-,11-7- |
| InChIKey | GFNYCWLZIUSUFN-LUSRJCCPSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|